C26H36N4O7 — CID 135177213
2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[8-(2-methoxyethylamino)octyl]acetamide (PubChem CID 135177213) has the molecular formula C26H36N4O7 and a molecular weight of 516.60 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[8-(2-methoxyethylamino)octyl]acetamide.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[8-(2-methoxyethylamino)octyl]acetamide |
|---|---|
| PubChem CID | 135177213 |
| Molecular Formula | C26H36N4O7 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[8-(2-methoxyethylamino)octyl]acetamide |
| SMILES | COCCNCCCCCCCCNC(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C26H36N4O7/c1-36-16-15-27-13-6-4-2-3-5-7-14-28-22(32)17-37-20-10-8-9-18-23(20)26(35)30(25(18)34)19-11-12-21(31)29-24(19)33/h8-10,19,27H,2-7,11-17H2,1H3,(H,28,32)(H,29,31,33) |
| InChIKey | ISGKVFQSRNMMKX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|