C31H37N5O6 — CID 163732964
2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[6-(4-phenylpiperazin-1-yl)hexyl]acetamide (PubChem CID 163732964) has the molecular formula C31H37N5O6 and a molecular weight of 575.67 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[6-(4-phenylpiperazin-1-yl)hexyl]acetamide.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[6-(4-phenylpiperazin-1-yl)hexyl]acetamide |
|---|---|
| PubChem CID | 163732964 |
| Molecular Formula | C31H37N5O6 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[6-(4-phenylpiperazin-1-yl)hexyl]acetamide |
| SMILES | O=C(COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)NCCCCCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C31H37N5O6/c37-26-14-13-24(29(39)33-26)36-30(40)23-11-8-12-25(28(23)31(36)41)42-21-27(38)32-15-6-1-2-7-16-34-17-19-35(20-18-34)22-9-4-3-5-10-22/h3-5,8-12,24H,1-2,6-7,13-21H2,(H,32,38)(H,33,37,39) |
| InChIKey | LBELQUDAHNSMMO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|