C22H26N4O7 — CID 155279746
6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]-N-methylhexanamide (PubChem CID 155279746) has the molecular formula C22H26N4O7 and a molecular weight of 458.47 g/mol. Its IUPAC name is 6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]-N-methylhexanamide.
| Compound Name | 6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]-N-methylhexanamide |
|---|---|
| PubChem CID | 155279746 |
| Molecular Formula | C22H26N4O7 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]-N-methylhexanamide |
| SMILES | CNC(=O)CCCCCNC(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H26N4O7/c1-23-16(27)8-3-2-4-11-24-18(29)12-33-15-7-5-6-13-19(15)22(32)26(21(13)31)14-9-10-17(28)25-20(14)30/h5-7,14H,2-4,8-12H2,1H3,(H,23,27)(H,24,29)(H,25,28,30) |
| InChIKey | ZTKWHPNLXHJAKX-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|