C21H27N3O8 — CID 178004650
2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[2-(2-hydroxyethoxy)ethyl]acetamide;ethane (PubChem CID 178004650) has the molecular formula C21H27N3O8 and a molecular weight of 449.46 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[2-(2-hydroxyethoxy)ethyl]acetamide;ethane.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[2-(2-hydroxyethoxy)ethyl]acetamide;ethane |
|---|---|
| PubChem CID | 178004650 |
| Molecular Formula | C21H27N3O8 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[2-(2-hydroxyethoxy)ethyl]acetamide;ethane |
| SMILES | CC.O=C(COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)NCCOCCO |
| InChI | InChI=1S/C19H21N3O8.C2H6/c23-7-9-29-8-6-20-15(25)10-30-13-3-1-2-11-16(13)19(28)22(18(11)27)12-4-5-14(24)21-17(12)26;1-2/h1-3,12,23H,4-10H2,(H,20,25)(H,21,24,26);1-2H3 |
| InChIKey | QAFQLWICDYKCRS-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|