C18H17N3O7 — CID 155195023
2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-(3-oxopropyl)acetamide (PubChem CID 155195023) has the molecular formula C18H17N3O7 and a molecular weight of 387.35 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-(3-oxopropyl)acetamide.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-(3-oxopropyl)acetamide |
|---|---|
| PubChem CID | 155195023 |
| Molecular Formula | C18H17N3O7 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-(3-oxopropyl)acetamide |
| SMILES | O=CCCNC(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C18H17N3O7/c22-8-2-7-19-14(24)9-28-12-4-1-3-10-15(12)18(27)21(17(10)26)11-5-6-13(23)20-16(11)25/h1,3-4,8,11H,2,5-7,9H2,(H,19,24)(H,20,23,25) |
| InChIKey | MOUCHLKAUFSVJB-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|