C25H32N4O11 — CID 167048791
N-[2-[2-[2-[2-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]ethoxy]ethoxy]ethoxy]ethyl]-2-hydroxyacetamide (PubChem CID 167048791) has the molecular formula C25H32N4O11 and a molecular weight of 564.55 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]ethoxy]ethoxy]ethoxy]ethyl]-2-hydroxyacetamide.
| Compound Name | N-[2-[2-[2-[2-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]ethoxy]ethoxy]ethoxy]ethyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 167048791 |
| Molecular Formula | C25H32N4O11 |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | N-[2-[2-[2-[2-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]ethoxy]ethoxy]ethoxy]ethyl]-2-hydroxyacetamide |
| SMILES | O=C(CO)NCCOCCOCCOCCNC(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C25H32N4O11/c30-14-20(32)26-6-8-37-10-12-39-13-11-38-9-7-27-21(33)15-40-18-3-1-2-16-22(18)25(36)29(24(16)35)17-4-5-19(31)28-23(17)34/h1-3,17,30H,4-15H2,(H,26,32)(H,27,33)(H,28,31,34) |
| InChIKey | MBKSHDCWMDYTAH-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 198.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|