C21H25N3O7 — CID 135144010
N-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1-methylidene-3-oxoisoindol-4-yl]oxyethoxy]ethyl]-2-methoxyacetamide (PubChem CID 135144010) has the molecular formula C21H25N3O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is N-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1-methylidene-3-oxoisoindol-4-yl]oxyethoxy]ethyl]-2-methoxyacetamide.
| Compound Name | N-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1-methylidene-3-oxoisoindol-4-yl]oxyethoxy]ethyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 135144010 |
| Molecular Formula | C21H25N3O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1-methylidene-3-oxoisoindol-4-yl]oxyethoxy]ethyl]-2-methoxyacetamide |
| SMILES | C=C1c2cccc(OCCOCCNC(=O)COC)c2C(=O)N1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C21H25N3O7/c1-13-14-4-3-5-16(31-11-10-30-9-8-22-18(26)12-29-2)19(14)21(28)24(13)15-6-7-17(25)23-20(15)27/h3-5,15H,1,6-12H2,2H3,(H,22,26)(H,23,25,27) |
| InChIKey | QYVRGFMFHDMOLA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|