C29H37N3O9 — CID 160655496
(2S)-4-[[11-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-10-oxoundecyl]amino]-2-methyl-4-oxobutanoic acid (PubChem CID 160655496) has the molecular formula C29H37N3O9 and a molecular weight of 571.63 g/mol. Its IUPAC name is (2S)-4-[[11-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-10-oxoundecyl]amino]-2-methyl-4-oxobutanoic acid.
| Compound Name | (2S)-4-[[11-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-10-oxoundecyl]amino]-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 160655496 |
| Molecular Formula | C29H37N3O9 |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | (2S)-4-[[11-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-10-oxoundecyl]amino]-2-methyl-4-oxobutanoic acid |
| SMILES | C[C@@H](CC(=O)NCCCCCCCCCC(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)C(=O)O |
| InChI | InChI=1S/C29H37N3O9/c1-18(29(39)40)16-24(35)30-15-8-6-4-2-3-5-7-10-19(33)17-41-22-12-9-11-20-25(22)28(38)32(27(20)37)21-13-14-23(34)31-26(21)36/h9,11-12,18,21H,2-8,10,13-17H2,1H3,(H,30,35)(H,39,40)(H,31,34,36)/t18-,21?/m0/s1 |
| InChIKey | UJXBPSMCMHHHKP-YMXDCFFPSA-N |
| XLogP | 2.38 |
| TPSA | 176.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|