C27H34N2O8 — CID 157241520
tert-butyl (2S)-9-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-2-methyl-8-oxononanoate (PubChem CID 157241520) has the molecular formula C27H34N2O8 and a molecular weight of 514.58 g/mol. Its IUPAC name is tert-butyl (2S)-9-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-2-methyl-8-oxononanoate.
| Compound Name | tert-butyl (2S)-9-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-2-methyl-8-oxononanoate |
|---|---|
| PubChem CID | 157241520 |
| Molecular Formula | C27H34N2O8 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | tert-butyl (2S)-9-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-2-methyl-8-oxononanoate |
| SMILES | C[C@@H](CCCCCC(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H34N2O8/c1-16(26(35)37-27(2,3)4)9-6-5-7-10-17(30)15-36-20-12-8-11-18-22(20)25(34)29(24(18)33)19-13-14-21(31)28-23(19)32/h8,11-12,16,19H,5-7,9-10,13-15H2,1-4H3,(H,28,31,32)/t16-,19?/m0/s1 |
| InChIKey | NBPXVERAQAMDCH-UCFFOFKASA-N |
| XLogP | 2.96 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|