C24H27F3N2O6 — CID 158386851
2-(2,6-dioxopiperidin-3-yl)-4-(11,11,11-trifluoro-2-oxoundecoxy)isoindole-1,3-dione (PubChem CID 158386851) has the molecular formula C24H27F3N2O6 and a molecular weight of 496.48 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(11,11,11-trifluoro-2-oxoundecoxy)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(11,11,11-trifluoro-2-oxoundecoxy)isoindole-1,3-dione |
|---|---|
| PubChem CID | 158386851 |
| Molecular Formula | C24H27F3N2O6 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(11,11,11-trifluoro-2-oxoundecoxy)isoindole-1,3-dione |
| SMILES | O=C(CCCCCCCCC(F)(F)F)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H27F3N2O6/c25-24(26,27)13-6-4-2-1-3-5-8-15(30)14-35-18-10-7-9-16-20(18)23(34)29(22(16)33)17-11-12-19(31)28-21(17)32/h7,9-10,17H,1-6,8,11-14H2,(H,28,31,32) |
| InChIKey | XJJPBQDQBKMFCS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|