C26H33N5O10 — CID 167690307
4-[5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-oxopentoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167690307) has the molecular formula C26H33N5O10 and a molecular weight of 575.58 g/mol. Its IUPAC name is 4-[5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-oxopentoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-oxopentoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167690307 |
| Molecular Formula | C26H33N5O10 |
| Molecular Weight | 575.58 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | 4-[5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-oxopentoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCCC(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C26H33N5O10/c27-30-28-8-10-38-12-14-40-16-15-39-13-11-37-9-2-3-18(32)17-41-21-5-1-4-19-23(21)26(36)31(25(19)35)20-6-7-22(33)29-24(20)34/h1,4-5,20H,2-3,6-17H2,(H,29,33,34) |
| InChIKey | WVIMEQHZFHMPLV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 195.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.58 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|