C21H25N5O8S — CID 153351547
4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylsulfinyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 153351547) has the molecular formula C21H25N5O8S and a molecular weight of 507.53 g/mol. Its IUPAC name is 4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylsulfinyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylsulfinyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 153351547 |
| Molecular Formula | C21H25N5O8S |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | 4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylsulfinyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCS(=O)c1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H25N5O8S/c22-25-23-6-7-32-8-9-33-10-11-34-12-13-35(31)16-3-1-2-14-18(16)21(30)26(20(14)29)15-4-5-17(27)24-19(15)28/h1-3,15H,4-13H2,(H,24,27,28) |
| InChIKey | PDDJYOYPWIEDSS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 177.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|