C27H30N2O8S2 — CID 150364211
7-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfinylheptyl 4-methylbenzenesulfonate (PubChem CID 150364211) has the molecular formula C27H30N2O8S2 and a molecular weight of 574.68 g/mol. Its IUPAC name is 7-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfinylheptyl 4-methylbenzenesulfonate.
| Compound Name | 7-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfinylheptyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 150364211 |
| Molecular Formula | C27H30N2O8S2 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | 7-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfinylheptyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCCS(=O)c2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C27H30N2O8S2/c1-18-10-12-19(13-11-18)39(35,36)37-16-5-3-2-4-6-17-38(34)22-9-7-8-20-24(22)27(33)29(26(20)32)21-14-15-23(30)28-25(21)31/h7-13,21H,2-6,14-17H2,1H3,(H,28,30,31) |
| InChIKey | GWISRCIYQVEXFE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|