C21H18N2O7S — CID 168871630
[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 168871630) has the molecular formula C21H18N2O7S and a molecular weight of 442.45 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 168871630 |
| Molecular Formula | C21H18N2O7S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C21H18N2O7S/c1-12-5-7-14(8-6-12)31(28,29)30-11-13-3-2-4-15-18(13)21(27)23(20(15)26)16-9-10-17(24)22-19(16)25/h2-8,16H,9-11H2,1H3,(H,22,24,25) |
| InChIKey | RWQLBRSEDAYDHV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|