C28H32N2O10S2 — CID 153351898
2-[2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfanylethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 153351898) has the molecular formula C28H32N2O10S2 and a molecular weight of 620.70 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfanylethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfanylethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 153351898 |
| Molecular Formula | C28H32N2O10S2 |
| Molecular Weight | 620.70 g/mol |
| Exact Mass | 620.15 |
| IUPAC Name | 2-[2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfanylethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCSc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C28H32N2O10S2/c1-19-5-7-20(8-6-19)42(35,36)40-16-15-38-12-11-37-13-14-39-17-18-41-23-4-2-3-21-25(23)28(34)30(27(21)33)22-9-10-24(31)29-26(22)32/h2-8,22H,9-18H2,1H3,(H,29,31,32) |
| InChIKey | YUXOJSWNIKEKJF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.70 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|