C25H26N2O8S — CID 171566923
2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 171566923) has the molecular formula C25H26N2O8S and a molecular weight of 514.56 g/mol. Its IUPAC name is 2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171566923 |
| Molecular Formula | C25H26N2O8S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C25H26N2O8S/c1-16-4-7-18(8-5-16)36(32,33)35-14-13-34-12-2-3-17-6-9-19-20(15-17)25(31)27(24(19)30)21-10-11-22(28)26-23(21)29/h4-9,15,21H,2-3,10-14H2,1H3,(H,26,28,29) |
| InChIKey | VAXGQMMFTZAJNR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|