C17H18N2O4 — CID 157474778
5-butyl-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 157474778) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 5-butyl-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-butyl-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 157474778 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 5-butyl-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CCCCc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C17H18N2O4/c1-2-3-4-10-5-6-11-12(9-10)17(23)19(16(11)22)13-7-8-14(20)18-15(13)21/h5-6,9,13H,2-4,7-8H2,1H3,(H,18,20,21) |
| InChIKey | YUFCTQSPMMPBJI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|