C19H22N2O8S — CID 161284436
2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propoxy]ethyl methanesulfonate (PubChem CID 161284436) has the molecular formula C19H22N2O8S and a molecular weight of 438.46 g/mol. Its IUPAC name is 2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propoxy]ethyl methanesulfonate.
| Compound Name | 2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 161284436 |
| Molecular Formula | C19H22N2O8S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propoxy]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCOCCCc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C19H22N2O8S/c1-30(26,27)29-10-9-28-8-2-3-12-4-5-13-14(11-12)19(25)21(18(13)24)15-6-7-16(22)20-17(15)23/h4-5,11,15H,2-3,6-10H2,1H3,(H,20,22,23) |
| InChIKey | URKNSTAAGUKJSD-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|