C21H21N3O6S2 — CID 166425543
N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-3-methylthiophene-2-sulfonamide (PubChem CID 166425543) has the molecular formula C21H21N3O6S2 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-3-methylthiophene-2-sulfonamide.
| Compound Name | N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-3-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 166425543 |
| Molecular Formula | C21H21N3O6S2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-3-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccsc1S(=O)(=O)NCCCc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H21N3O6S2/c1-12-8-10-31-21(12)32(29,30)22-9-2-3-13-4-5-14-15(11-13)20(28)24(19(14)27)16-6-7-17(25)23-18(16)26/h4-5,8,10-11,16,22H,2-3,6-7,9H2,1H3,(H,23,25,26) |
| InChIKey | HPWQJDCEHYRDDU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|