C23H28N4O6 — CID 166425521
(2R,6S)-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-2,6-dimethylmorpholine-4-carboxamide (PubChem CID 166425521) has the molecular formula C23H28N4O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is (2R,6S)-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-2,6-dimethylmorpholine-4-carboxamide.
| Compound Name | (2R,6S)-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-2,6-dimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 166425521 |
| Molecular Formula | C23H28N4O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (2R,6S)-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-2,6-dimethylmorpholine-4-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)NCCCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)C[C@H](C)O1 |
| InChI | InChI=1S/C23H28N4O6/c1-13-11-26(12-14(2)33-13)23(32)24-9-3-4-15-5-6-16-17(10-15)22(31)27(21(16)30)18-7-8-19(28)25-20(18)29/h5-6,10,13-14,18H,3-4,7-9,11-12H2,1-2H3,(H,24,32)(H,25,28,29)/t13-,14+,18? |
| InChIKey | XDQFTEFDFUUYCL-UUVAVEHKSA-N |
| XLogP | 0.84 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|