C24H25N5O7 — CID 167961125
N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-N'-(4-propan-2-yl-1,2-oxazol-3-yl)oxamide (PubChem CID 167961125) has the molecular formula C24H25N5O7 and a molecular weight of 495.49 g/mol. Its IUPAC name is N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-N'-(4-propan-2-yl-1,2-oxazol-3-yl)oxamide.
| Compound Name | N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-N'-(4-propan-2-yl-1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 167961125 |
| Molecular Formula | C24H25N5O7 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-N'-(4-propan-2-yl-1,2-oxazol-3-yl)oxamide |
| SMILES | CC(C)c1conc1NC(=O)C(=O)NCCCc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H25N5O7/c1-12(2)16-11-36-28-19(16)27-22(33)21(32)25-9-3-4-13-5-6-14-15(10-13)24(35)29(23(14)34)17-7-8-18(30)26-20(17)31/h5-6,10-12,17H,3-4,7-9H2,1-2H3,(H,25,32)(H,26,30,31)(H,27,28,33) |
| InChIKey | FOUAOUQFAPBGCN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 167.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|