C24H23N7O5 — CID 166425552
1-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-3-(6-methylpyrazolo[1,5-a]pyrimidin-3-yl)urea (PubChem CID 166425552) has the molecular formula C24H23N7O5 and a molecular weight of 489.49 g/mol. Its IUPAC name is 1-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-3-(6-methylpyrazolo[1,5-a]pyrimidin-3-yl)urea.
| Compound Name | 1-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-3-(6-methylpyrazolo[1,5-a]pyrimidin-3-yl)urea |
|---|---|
| PubChem CID | 166425552 |
| Molecular Formula | C24H23N7O5 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 1-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-3-(6-methylpyrazolo[1,5-a]pyrimidin-3-yl)urea |
| SMILES | Cc1cnc2c(NC(=O)NCCCc3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)cnn2c1 |
| InChI | InChI=1S/C24H23N7O5/c1-13-10-26-20-17(11-27-30(20)12-13)28-24(36)25-8-2-3-14-4-5-15-16(9-14)23(35)31(22(15)34)18-6-7-19(32)29-21(18)33/h4-5,9-12,18H,2-3,6-8H2,1H3,(H2,25,28,36)(H,29,32,33) |
| InChIKey | QYQNIHQBRNYAPF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 154.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|