C27H24N4O5 — CID 166425463
N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-3-pyrrol-1-ylbenzamide (PubChem CID 166425463) has the molecular formula C27H24N4O5 and a molecular weight of 484.51 g/mol. Its IUPAC name is N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-3-pyrrol-1-ylbenzamide.
| Compound Name | N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-3-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 166425463 |
| Molecular Formula | C27H24N4O5 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-3-pyrrol-1-ylbenzamide |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CCCNC(=O)c4cccc(-n5cccc5)c4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H24N4O5/c32-23-11-10-22(25(34)29-23)31-26(35)20-9-8-17(15-21(20)27(31)36)5-4-12-28-24(33)18-6-3-7-19(16-18)30-13-1-2-14-30/h1-3,6-9,13-16,22H,4-5,10-12H2,(H,28,33)(H,29,32,34) |
| InChIKey | SUZREHRKMVPXEH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|