C17H19ClN4O5 — CID 166000888
N-(3-aminopropyl)-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carboxamide;hydrochloride (PubChem CID 166000888) has the molecular formula C17H19ClN4O5 and a molecular weight of 394.82 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 166000888 |
| Molecular Formula | C17H19ClN4O5 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-(3-aminopropyl)-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carboxamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)c1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C17H18N4O5.ClH/c18-6-1-7-19-14(23)9-2-3-10-11(8-9)17(26)21(16(10)25)12-4-5-13(22)20-15(12)24;/h2-3,8,12H,1,4-7,18H2,(H,19,23)(H,20,22,24);1H |
| InChIKey | WPBHPSJMNISFQD-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|