C22H25N3O5 — CID 166426918
2-(2,6-dioxopiperidin-3-yl)-N-[(1-ethylcyclopentyl)methyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 166426918) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-N-[(1-ethylcyclopentyl)methyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-N-[(1-ethylcyclopentyl)methyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 166426918 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-N-[(1-ethylcyclopentyl)methyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCC1(CNC(=O)c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CCCC1 |
| InChI | InChI=1S/C22H25N3O5/c1-2-22(9-3-4-10-22)12-23-18(27)13-5-6-14-15(11-13)21(30)25(20(14)29)16-7-8-17(26)24-19(16)28/h5-6,11,16H,2-4,7-10,12H2,1H3,(H,23,27)(H,24,26,28) |
| InChIKey | MYMHQXLKDJYVRI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|