C22H22N4O6 — CID 166426954
N-[(4-tert-butyl-1,2-oxazol-3-yl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 166426954) has the molecular formula C22H22N4O6 and a molecular weight of 438.44 g/mol. Its IUPAC name is N-[(4-tert-butyl-1,2-oxazol-3-yl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[(4-tert-butyl-1,2-oxazol-3-yl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 166426954 |
| Molecular Formula | C22H22N4O6 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-[(4-tert-butyl-1,2-oxazol-3-yl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CC(C)(C)c1conc1CNC(=O)c1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H22N4O6/c1-22(2,3)14-10-32-25-15(14)9-23-18(28)11-4-5-12-13(8-11)21(31)26(20(12)30)16-6-7-17(27)24-19(16)29/h4-5,8,10,16H,6-7,9H2,1-3H3,(H,23,28)(H,24,27,29) |
| InChIKey | GOYXSZLBWUKYDL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|