C23H18FN3O7 — CID 166426895
2-(2,6-dioxopiperidin-3-yl)-N-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 166426895) has the molecular formula C23H18FN3O7 and a molecular weight of 467.41 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-N-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-N-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 166426895 |
| Molecular Formula | C23H18FN3O7 |
| Molecular Weight | 467.41 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-N-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C1CCC(N2C(=O)c3ccc(C(=O)NCc4cc(F)cc5c4OCOC5)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H18FN3O7/c24-14-5-12(19-13(6-14)9-33-10-34-19)8-25-20(29)11-1-2-15-16(7-11)23(32)27(22(15)31)17-3-4-18(28)26-21(17)30/h1-2,5-7,17H,3-4,8-10H2,(H,25,29)(H,26,28,30) |
| InChIKey | JNAVMOBSUPBIDD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|