C22H19N3O6 — CID 71213468
N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-4-(hydroxymethyl)benzamide (PubChem CID 71213468) has the molecular formula C22H19N3O6 and a molecular weight of 421.41 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-4-(hydroxymethyl)benzamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-4-(hydroxymethyl)benzamide |
|---|---|
| PubChem CID | 71213468 |
| Molecular Formula | C22H19N3O6 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-4-(hydroxymethyl)benzamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CNC(=O)c4ccc(CO)cc4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H19N3O6/c26-11-12-4-6-13(7-5-12)19(28)23-10-14-2-1-3-15-18(14)22(31)25(21(15)30)16-8-9-17(27)24-20(16)29/h1-7,16,26H,8-11H2,(H,23,28)(H,24,27,29) |
| InChIKey | RMAHUYIETVOTGD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|