C20H19N5O5 — CID 58827322
N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-1,5-dimethylpyrazole-3-carboxamide (PubChem CID 58827322) has the molecular formula C20H19N5O5 and a molecular weight of 409.40 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-1,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-1,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 58827322 |
| Molecular Formula | C20H19N5O5 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-1,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)nn1C |
| InChI | InChI=1S/C20H19N5O5/c1-10-8-13(23-24(10)2)17(27)21-9-11-4-3-5-12-16(11)20(30)25(19(12)29)14-6-7-15(26)22-18(14)28/h3-5,8,14H,6-7,9H2,1-2H3,(H,21,27)(H,22,26,28) |
| InChIKey | RCNWEMHLISFGMG-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|