C27H20BN3O7 — CID 170652362
N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-2-phenyl-1,3,2-benzodioxaborole-5-carboxamide (PubChem CID 170652362) has the molecular formula C27H20BN3O7 and a molecular weight of 509.28 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-2-phenyl-1,3,2-benzodioxaborole-5-carboxamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-2-phenyl-1,3,2-benzodioxaborole-5-carboxamide |
|---|---|
| PubChem CID | 170652362 |
| Molecular Formula | C27H20BN3O7 |
| Molecular Weight | 509.28 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-2-phenyl-1,3,2-benzodioxaborole-5-carboxamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CNC(=O)c4ccc5c(c4)OB(c4ccccc4)O5)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H20BN3O7/c32-22-12-10-19(25(34)30-22)31-26(35)18-8-4-5-16(23(18)27(31)36)14-29-24(33)15-9-11-20-21(13-15)38-28(37-20)17-6-2-1-3-7-17/h1-9,11,13,19H,10,12,14H2,(H,29,33)(H,30,32,34) |
| InChIKey | PLBDFTKMDSSXPT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|