C23H18N2O7 — CID 58307284
N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 58307284) has the molecular formula C23H18N2O7 and a molecular weight of 434.40 g/mol. Its IUPAC name is N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 58307284 |
| Molecular Formula | C23H18N2O7 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CNC(=O)c4ccc5c(c4)OCO5)c3C2=O)C(=O)C1 |
| InChI | InChI=1S/C23H18N2O7/c26-14-5-6-16(17(27)9-14)25-22(29)15-3-1-2-13(20(15)23(25)30)10-24-21(28)12-4-7-18-19(8-12)32-11-31-18/h1-4,7-8,16H,5-6,9-11H2,(H,24,28) |
| InChIKey | RBKGGJLHUVMVQL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|