C24H18N4O5 — CID 58307246
N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]quinoxaline-2-carboxamide (PubChem CID 58307246) has the molecular formula C24H18N4O5 and a molecular weight of 442.43 g/mol. Its IUPAC name is N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]quinoxaline-2-carboxamide.
| Compound Name | N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 58307246 |
| Molecular Formula | C24H18N4O5 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]quinoxaline-2-carboxamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CNC(=O)c4cnc5ccccc5n4)c3C2=O)C(=O)C1 |
| InChI | InChI=1S/C24H18N4O5/c29-14-8-9-19(20(30)10-14)28-23(32)15-5-3-4-13(21(15)24(28)33)11-26-22(31)18-12-25-16-6-1-2-7-17(16)27-18/h1-7,12,19H,8-11H2,(H,26,31) |
| InChIKey | MBDOUTAXYBKRIX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|