C25H20N2O7 — CID 58307187
N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-6-methoxy-1-benzofuran-3-carboxamide (PubChem CID 58307187) has the molecular formula C25H20N2O7 and a molecular weight of 460.44 g/mol. Its IUPAC name is N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-6-methoxy-1-benzofuran-3-carboxamide.
| Compound Name | N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-6-methoxy-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 58307187 |
| Molecular Formula | C25H20N2O7 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | N-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-6-methoxy-1-benzofuran-3-carboxamide |
| SMILES | COc1ccc2c(C(=O)NCc3cccc4c3C(=O)N(C3CCC(=O)CC3=O)C4=O)coc2c1 |
| InChI | InChI=1S/C25H20N2O7/c1-33-15-6-7-16-18(12-34-21(16)10-15)23(30)26-11-13-3-2-4-17-22(13)25(32)27(24(17)31)19-8-5-14(28)9-20(19)29/h2-4,6-7,10,12,19H,5,8-9,11H2,1H3,(H,26,30) |
| InChIKey | OOMJYESUFJWWDO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|