C18H19N3O5 — CID 58307221
3-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-1,1-dimethylurea (PubChem CID 58307221) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 3-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-1,1-dimethylurea.
| Compound Name | 3-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 58307221 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 3-[[2-(2,4-dioxocyclohexyl)-1,3-dioxoisoindol-4-yl]methyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCc1cccc2c1C(=O)N(C1CCC(=O)CC1=O)C2=O |
| InChI | InChI=1S/C18H19N3O5/c1-20(2)18(26)19-9-10-4-3-5-12-15(10)17(25)21(16(12)24)13-7-6-11(22)8-14(13)23/h3-5,13H,6-9H2,1-2H3,(H,19,26) |
| InChIKey | VQYASGBNWNGZBI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|