C25H25N3O5 — CID 123831828
1-[[2-(2,5-dioxocycloheptyl)-1,3-dioxoisoindol-4-yl]methyl]-1-methyl-3-(4-methylphenyl)urea (PubChem CID 123831828) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is 1-[[2-(2,5-dioxocycloheptyl)-1,3-dioxoisoindol-4-yl]methyl]-1-methyl-3-(4-methylphenyl)urea.
| Compound Name | 1-[[2-(2,5-dioxocycloheptyl)-1,3-dioxoisoindol-4-yl]methyl]-1-methyl-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 123831828 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 1-[[2-(2,5-dioxocycloheptyl)-1,3-dioxoisoindol-4-yl]methyl]-1-methyl-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)N(C)Cc2cccc3c2C(=O)N(C2CCC(=O)CCC2=O)C3=O)cc1 |
| InChI | InChI=1S/C25H25N3O5/c1-15-6-8-17(9-7-15)26-25(33)27(2)14-16-4-3-5-19-22(16)24(32)28(23(19)31)20-12-10-18(29)11-13-21(20)30/h3-9,20H,10-14H2,1-2H3,(H,26,33) |
| InChIKey | NXDZJZDSCLOFJP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|