C21H27N3O4 — CID 158601626
3-tert-butyl-1-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-4-yl]methyl]-1-methylurea (PubChem CID 158601626) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 3-tert-butyl-1-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-4-yl]methyl]-1-methylurea.
| Compound Name | 3-tert-butyl-1-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-4-yl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 158601626 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 3-tert-butyl-1-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-4-yl]methyl]-1-methylurea |
| SMILES | CN(Cc1cccc2c1CN(C1CCC(=O)CC1=O)C2=O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H27N3O4/c1-21(2,3)22-20(28)23(4)11-13-6-5-7-15-16(13)12-24(19(15)27)17-9-8-14(25)10-18(17)26/h5-7,17H,8-12H2,1-4H3,(H,22,28) |
| InChIKey | HVRZKXCIQDPBDC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|