C22H21ClN4O4 — CID 24895847
3-(3-chlorophenyl)-1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]-1-methylurea (PubChem CID 24895847) has the molecular formula C22H21ClN4O4 and a molecular weight of 440.89 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]-1-methylurea.
| Compound Name | 3-(3-chlorophenyl)-1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 24895847 |
| Molecular Formula | C22H21ClN4O4 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]-1-methylurea |
| SMILES | CN(Cc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H21ClN4O4/c1-26(22(31)24-15-6-3-5-14(23)10-15)11-13-4-2-7-16-17(13)12-27(21(16)30)18-8-9-19(28)25-20(18)29/h2-7,10,18H,8-9,11-12H2,1H3,(H,24,31)(H,25,28,29) |
| InChIKey | KKNRCHVDDWQDBV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|