C23H22N4O6 — CID 24896340
1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-3-(3-methoxyphenyl)-1-methylurea (PubChem CID 24896340) has the molecular formula C23H22N4O6 and a molecular weight of 450.45 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-3-(3-methoxyphenyl)-1-methylurea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-3-(3-methoxyphenyl)-1-methylurea |
|---|---|
| PubChem CID | 24896340 |
| Molecular Formula | C23H22N4O6 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-3-(3-methoxyphenyl)-1-methylurea |
| SMILES | COc1cccc(NC(=O)N(C)Cc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C23H22N4O6/c1-26(23(32)24-14-6-4-7-15(11-14)33-2)12-13-5-3-8-16-19(13)22(31)27(21(16)30)17-9-10-18(28)25-20(17)29/h3-8,11,17H,9-10,12H2,1-2H3,(H,24,32)(H,25,28,29) |
| InChIKey | UPZIYCZNVWWHGE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|