C22H20N4O6 — CID 58827288
1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-3-[3-(hydroxymethyl)phenyl]urea (PubChem CID 58827288) has the molecular formula C22H20N4O6 and a molecular weight of 436.42 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-3-[3-(hydroxymethyl)phenyl]urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-3-[3-(hydroxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 58827288 |
| Molecular Formula | C22H20N4O6 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-3-[3-(hydroxymethyl)phenyl]urea |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CNC(=O)Nc4cccc(CO)c4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H20N4O6/c27-11-12-3-1-5-14(9-12)24-22(32)23-10-13-4-2-6-15-18(13)21(31)26(20(15)30)16-7-8-17(28)25-19(16)29/h1-6,9,16,27H,7-8,10-11H2,(H2,23,24,32)(H,25,28,29) |
| InChIKey | WZARHCHFARMDEF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|