C22H18FN3O5 — CID 58827351
N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-2-fluoro-4-methylbenzamide (PubChem CID 58827351) has the molecular formula C22H18FN3O5 and a molecular weight of 423.40 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-2-fluoro-4-methylbenzamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-2-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 58827351 |
| Molecular Formula | C22H18FN3O5 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methyl]-2-fluoro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)c(F)c1 |
| InChI | InChI=1S/C22H18FN3O5/c1-11-5-6-13(15(23)9-11)19(28)24-10-12-3-2-4-14-18(12)22(31)26(21(14)30)16-7-8-17(27)25-20(16)29/h2-6,9,16H,7-8,10H2,1H3,(H,24,28)(H,25,27,29) |
| InChIKey | VBSFWKFJUUUZNX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|