C29H34N2O3 — CID 159942197
3-(4-tert-butylphenyl)-N-[[2-[(1S)-4-methylidene-2-oxocyclohexyl]-1-oxo-3H-isoindol-4-yl]methyl]propanamide (PubChem CID 159942197) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-[[2-[(1S)-4-methylidene-2-oxocyclohexyl]-1-oxo-3H-isoindol-4-yl]methyl]propanamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-[[2-[(1S)-4-methylidene-2-oxocyclohexyl]-1-oxo-3H-isoindol-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 159942197 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-[[2-[(1S)-4-methylidene-2-oxocyclohexyl]-1-oxo-3H-isoindol-4-yl]methyl]propanamide |
| SMILES | C=C1CC[C@H](N2Cc3c(CNC(=O)CCc4ccc(C(C)(C)C)cc4)cccc3C2=O)C(=O)C1 |
| InChI | InChI=1S/C29H34N2O3/c1-19-8-14-25(26(32)16-19)31-18-24-21(6-5-7-23(24)28(31)34)17-30-27(33)15-11-20-9-12-22(13-10-20)29(2,3)4/h5-7,9-10,12-13,25H,1,8,11,14-18H2,2-4H3,(H,30,33)/t25-/m0/s1 |
| InChIKey | JNQMDQSMARUGHT-VWLOTQADSA-N |
| XLogP | 4.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|