C27H23N3O4 — CID 155354902
N-[[2-(6-methylidene-2-oxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]-2-naphthalen-2-yl-2-oxoacetamide (PubChem CID 155354902) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is N-[[2-(6-methylidene-2-oxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]-2-naphthalen-2-yl-2-oxoacetamide.
| Compound Name | N-[[2-(6-methylidene-2-oxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]-2-naphthalen-2-yl-2-oxoacetamide |
|---|---|
| PubChem CID | 155354902 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | N-[[2-(6-methylidene-2-oxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]-2-naphthalen-2-yl-2-oxoacetamide |
| SMILES | C=C1CCC(N2Cc3c(CNC(=O)C(=O)c4ccc5ccccc5c4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H23N3O4/c1-16-9-12-23(25(32)29-16)30-15-22-20(7-4-8-21(22)27(30)34)14-28-26(33)24(31)19-11-10-17-5-2-3-6-18(17)13-19/h2-8,10-11,13,23H,1,9,12,14-15H2,(H,28,33)(H,29,32) |
| InChIKey | LPSNFKSFBFRYEH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|