C23H18F3N3O5 — CID 155316219
N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]-2-oxo-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 155316219) has the molecular formula C23H18F3N3O5 and a molecular weight of 473.41 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]-2-oxo-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]-2-oxo-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 155316219 |
| Molecular Formula | C23H18F3N3O5 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]-2-oxo-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C1CCC(N2Cc3c(CNC(=O)C(=O)c4ccc(C(F)(F)F)cc4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H18F3N3O5/c24-23(25,26)14-6-4-12(5-7-14)19(31)21(33)27-10-13-2-1-3-15-16(13)11-29(22(15)34)17-8-9-18(30)28-20(17)32/h1-7,17H,8-11H2,(H,27,33)(H,28,30,32) |
| InChIKey | CEFRADKDQPLKPO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|