C20H17N3O6S — CID 155316294
N-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]-2-(4-hydroxyphenyl)-2-oxoacetamide (PubChem CID 155316294) has the molecular formula C20H17N3O6S and a molecular weight of 427.44 g/mol. Its IUPAC name is N-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]-2-(4-hydroxyphenyl)-2-oxoacetamide.
| Compound Name | N-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]-2-(4-hydroxyphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 155316294 |
| Molecular Formula | C20H17N3O6S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | N-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]-2-(4-hydroxyphenyl)-2-oxoacetamide |
| SMILES | O=C1CCC(N2Cc3c(csc3CNC(=O)C(=O)c3ccc(O)cc3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H17N3O6S/c24-11-3-1-10(2-4-11)17(26)19(28)21-7-15-12-8-23(20(29)13(12)9-30-15)14-5-6-16(25)22-18(14)27/h1-4,9,14,24H,5-8H2,(H,21,28)(H,22,25,27) |
| InChIKey | DFDFXGDKUPGLHY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|