C20H18N4O6S — CID 155316163
1-(1,3-benzodioxol-5-yl)-3-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]urea (PubChem CID 155316163) has the molecular formula C20H18N4O6S and a molecular weight of 442.45 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]urea |
|---|---|
| PubChem CID | 155316163 |
| Molecular Formula | C20H18N4O6S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]urea |
| SMILES | O=C1CCC(N2Cc3c(csc3CNC(=O)Nc3ccc4c(c3)OCO4)C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H18N4O6S/c25-17-4-2-13(18(26)23-17)24-7-11-12(19(24)27)8-31-16(11)6-21-20(28)22-10-1-3-14-15(5-10)30-9-29-14/h1,3,5,8,13H,2,4,6-7,9H2,(H2,21,22,28)(H,23,25,26) |
| InChIKey | LBDYRMGPPYJKLG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|