C25H26N4O6S — CID 155316244
N-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]-2-[4-(morpholin-4-ylmethyl)phenyl]-2-oxoacetamide (PubChem CID 155316244) has the molecular formula C25H26N4O6S and a molecular weight of 510.57 g/mol. Its IUPAC name is N-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]-2-[4-(morpholin-4-ylmethyl)phenyl]-2-oxoacetamide.
| Compound Name | N-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]-2-[4-(morpholin-4-ylmethyl)phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 155316244 |
| Molecular Formula | C25H26N4O6S |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | N-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]-2-[4-(morpholin-4-ylmethyl)phenyl]-2-oxoacetamide |
| SMILES | O=C1CCC(N2Cc3c(csc3CNC(=O)C(=O)c3ccc(CN4CCOCC4)cc3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H26N4O6S/c30-21-6-5-19(23(32)27-21)29-13-17-18(25(29)34)14-36-20(17)11-26-24(33)22(31)16-3-1-15(2-4-16)12-28-7-9-35-10-8-28/h1-4,14,19H,5-13H2,(H,26,33)(H,27,30,32) |
| InChIKey | MPLPFEOGDMRRBG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|