C20H23F3N4O5 — CID 145401176
3-[3-oxo-7-(piperazin-4-ium-1-ylmethyl)-1H-isoindol-2-yl]piperidine-2,6-dione;2,2,2-trifluoroacetate (PubChem CID 145401176) has the molecular formula C20H23F3N4O5 and a molecular weight of 456.42 g/mol. Its IUPAC name is 3-[3-oxo-7-(piperazin-4-ium-1-ylmethyl)-1H-isoindol-2-yl]piperidine-2,6-dione;2,2,2-trifluoroacetate.
| Compound Name | 3-[3-oxo-7-(piperazin-4-ium-1-ylmethyl)-1H-isoindol-2-yl]piperidine-2,6-dione;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 145401176 |
| Molecular Formula | C20H23F3N4O5 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[3-oxo-7-(piperazin-4-ium-1-ylmethyl)-1H-isoindol-2-yl]piperidine-2,6-dione;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.O=C1CCC(N2Cc3c(CN4CC[NH2+]CC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H22N4O3.C2HF3O2/c23-16-5-4-15(17(24)20-16)22-11-14-12(2-1-3-13(14)18(22)25)10-21-8-6-19-7-9-21;3-2(4,5)1(6)7/h1-3,15,19H,4-11H2,(H,20,23,24);(H,6,7) |
| InChIKey | ZNTUHJIVFSNKSS-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|