C18H24Cl2N4O3 — CID 167723330
3-[3-oxo-7-(piperazin-1-ylmethyl)-1H-isoindol-2-yl]piperidine-2,6-dione;dihydrochloride (PubChem CID 167723330) has the molecular formula C18H24Cl2N4O3 and a molecular weight of 415.32 g/mol. Its IUPAC name is 3-[3-oxo-7-(piperazin-1-ylmethyl)-1H-isoindol-2-yl]piperidine-2,6-dione;dihydrochloride.
| Compound Name | 3-[3-oxo-7-(piperazin-1-ylmethyl)-1H-isoindol-2-yl]piperidine-2,6-dione;dihydrochloride |
|---|---|
| PubChem CID | 167723330 |
| Molecular Formula | C18H24Cl2N4O3 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 3-[3-oxo-7-(piperazin-1-ylmethyl)-1H-isoindol-2-yl]piperidine-2,6-dione;dihydrochloride |
| SMILES | Cl.Cl.O=C1CCC(N2Cc3c(CN4CCNCC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H22N4O3.2ClH/c23-16-5-4-15(17(24)20-16)22-11-14-12(2-1-3-13(14)18(22)25)10-21-8-6-19-7-9-21;;/h1-3,15,19H,4-11H2,(H,20,23,24);2*1H |
| InChIKey | INEXNBJRUFAKEC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|