C23H30N4O4 — CID 167721635
3-[7-[[4-(3-hydroxypyrrolidin-3-yl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167721635) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is 3-[7-[[4-(3-hydroxypyrrolidin-3-yl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[4-(3-hydroxypyrrolidin-3-yl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167721635 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 3-[7-[[4-(3-hydroxypyrrolidin-3-yl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CN4CCC(C5(O)CCNC5)CC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H30N4O4/c28-20-5-4-19(21(29)25-20)27-13-18-15(2-1-3-17(18)22(27)30)12-26-10-6-16(7-11-26)23(31)8-9-24-14-23/h1-3,16,19,24,31H,4-14H2,(H,25,28,29) |
| InChIKey | MAMNHKSQNRVULG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|