C24H31N5O4 — CID 167718490
3-[3-oxo-7-[[4-[(2S)-piperidine-2-carbonyl]piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167718490) has the molecular formula C24H31N5O4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 3-[3-oxo-7-[[4-[(2S)-piperidine-2-carbonyl]piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[[4-[(2S)-piperidine-2-carbonyl]piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167718490 |
| Molecular Formula | C24H31N5O4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 3-[3-oxo-7-[[4-[(2S)-piperidine-2-carbonyl]piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CN4CCN(C(=O)[C@@H]5CCCCN5)CC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H31N5O4/c30-21-8-7-20(22(31)26-21)29-15-18-16(4-3-5-17(18)23(29)32)14-27-10-12-28(13-11-27)24(33)19-6-1-2-9-25-19/h3-5,19-20,25H,1-2,6-15H2,(H,26,30,31)/t19-,20?/m0/s1 |
| InChIKey | GJIRPMLISAUVJQ-XJDOXCRVSA-N |
| XLogP | 0.23 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|